6-fluoro-N-[(4-fluorophenyl)methyl]quinazolin-4-amine
Catalog No: FT-0700152
CAS No: 1262888-28-7
- Chemical Name: 6-fluoro-N-[(4-fluorophenyl)methyl]quinazolin-4-amine
- Molecular Formula: C15H11F2N3
- Molecular Weight: 271.26
- InChI Key: AWIVHRPYFSSVOG-UHFFFAOYSA-N
- InChI: InChI=1S/C15H11F2N3/c16-11-3-1-10(2-4-11)8-18-15-13-7-12(17)5-6-14(13)19-9-20-15/h1-7,9H,8H2,(H,18,19,20)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1262888-28-7 |
|---|---|
| MF: | C15H11F2N3 |
| Density: | 1.4±0.1 g/cm3 |
| Flash_Point: | 207.6±27.3 °C |
| Melting_Point: | N/A |
| Product_Name: | Spautin-1 |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | 419.6±40.0 °C at 760 mmHg |
| FW: | 271.265 |
| Bolling_Point: | 419.6±40.0 °C at 760 mmHg |
|---|---|
| Density: | 1.4±0.1 g/cm3 |
| MF: | C15H11F2N3 |
| LogP: | 3.40 |
| Exact_Mass: | 271.092102 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Flash_Point: | 207.6±27.3 °C |
| FW: | 271.265 |
| Refractive_Index: | 1.672 |
| PSA: | 37.81000 |
| Safety_Statements: | H302-H318 |
|---|---|
| Symbol: | GHS05, GHS07 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)